C26H28F2IN5O — CID 171484741
2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyridin-6-yl]-4-iodobenzamide (PubChem CID 171484741) has the molecular formula C26H28F2IN5O and a molecular weight of 591.44 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyridin-6-yl]-4-iodobenzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyridin-6-yl]-4-iodobenzamide |
|---|---|
| PubChem CID | 171484741 |
| Molecular Formula | C26H28F2IN5O |
| Molecular Weight | 591.44 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)pyrazolo[1,5-a]pyridin-6-yl]-4-iodobenzamide |
| SMILES | O=C(Nc1cc(N2CCC(F)(F)CC2)c2ccnn2c1)c1ccc(I)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C26H28F2IN5O/c27-26(28)8-13-33(14-9-26)23-16-19(17-34-21(23)3-10-30-34)31-24(35)20-2-1-18(29)15-22(20)32-11-6-25(4-5-25)7-12-32/h1-3,10,15-17H,4-9,11-14H2,(H,31,35) |
| InChIKey | QVIFJNHUZXVLET-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.44 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|