C22H40N4 — CID 167272891
(5E)-N-ethyl-3,3-dimethyl-4-methylidene-6-(4-piperazin-1-ylpiperidin-1-yl)octa-1,5-dien-2-amine (PubChem CID 167272891) has the molecular formula C22H40N4 and a molecular weight of 360.59 g/mol. Its IUPAC name is (5E)-N-ethyl-3,3-dimethyl-4-methylidene-6-(4-piperazin-1-ylpiperidin-1-yl)octa-1,5-dien-2-amine.
| Compound Name | (5E)-N-ethyl-3,3-dimethyl-4-methylidene-6-(4-piperazin-1-ylpiperidin-1-yl)octa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 167272891 |
| Molecular Formula | C22H40N4 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.33 |
| IUPAC Name | (5E)-N-ethyl-3,3-dimethyl-4-methylidene-6-(4-piperazin-1-ylpiperidin-1-yl)octa-1,5-dien-2-amine |
| SMILES | C=C(/C=C(\CC)N1CCC(N2CCNCC2)CC1)C(C)(C)C(=C)NCC |
| InChI | InChI=1S/C22H40N4/c1-7-20(17-18(3)22(5,6)19(4)24-8-2)25-13-9-21(10-14-25)26-15-11-23-12-16-26/h17,21,23-24H,3-4,7-16H2,1-2,5-6H3/b20-17+ |
| InChIKey | YKWNWSIYJOWAAB-LVZFUZTISA-N |
| XLogP | 3.36 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|