C38H57N7O4 — CID 167274788
4-[3-methyl-3-(methylamino)butoxy]-N-[3-[4-[2-[[4-[2-methyl-2-(methylamino)propyl]phenyl]methylamino]-2-oxoethoxy]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl]propyl]benzamide (PubChem CID 167274788) has the molecular formula C38H57N7O4 and a molecular weight of 675.92 g/mol. Its IUPAC name is 4-[3-methyl-3-(methylamino)butoxy]-N-[3-[4-[2-[[4-[2-methyl-2-(methylamino)propyl]phenyl]methylamino]-2-oxoethoxy]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl]propyl]benzamide.
| Compound Name | 4-[3-methyl-3-(methylamino)butoxy]-N-[3-[4-[2-[[4-[2-methyl-2-(methylamino)propyl]phenyl]methylamino]-2-oxoethoxy]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl]propyl]benzamide |
|---|---|
| PubChem CID | 167274788 |
| Molecular Formula | C38H57N7O4 |
| Molecular Weight | 675.92 g/mol |
| Exact Mass | 675.45 |
| IUPAC Name | 4-[3-methyl-3-(methylamino)butoxy]-N-[3-[4-[2-[[4-[2-methyl-2-(methylamino)propyl]phenyl]methylamino]-2-oxoethoxy]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl]propyl]benzamide |
| SMILES | CNC(C)(C)CCOc1ccc(C(=O)NCCCn2nnc3c2C(OCC(=O)NCc2ccc(CC(C)(C)NC)cc2)CCCCC3)cc1 |
| InChI | InChI=1S/C38H57N7O4/c1-37(2,39-5)21-24-48-31-19-17-30(18-20-31)36(47)41-22-10-23-45-35-32(43-44-45)11-8-7-9-12-33(35)49-27-34(46)42-26-29-15-13-28(14-16-29)25-38(3,4)40-6/h13-20,33,39-40H,7-12,21-27H2,1-6H3,(H,41,47)(H,42,46) |
| InChIKey | BHTGMUFIIZVDPU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 131.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.92 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|