C36H53N7O3 — CID 167275407
N-[3-[4-[2-[[4-(methylaminomethyl)phenyl]methylamino]-2-oxoethoxy]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-1-yl]propyl]-4-[4-methyl-4-(methylamino)pentyl]benzamide (PubChem CID 167275407) has the molecular formula C36H53N7O3 and a molecular weight of 631.87 g/mol. Its IUPAC name is N-[3-[4-[2-[[4-(methylaminomethyl)phenyl]methylamino]-2-oxoethoxy]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-1-yl]propyl]-4-[4-methyl-4-(methylamino)pentyl]benzamide.
| Compound Name | N-[3-[4-[2-[[4-(methylaminomethyl)phenyl]methylamino]-2-oxoethoxy]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-1-yl]propyl]-4-[4-methyl-4-(methylamino)pentyl]benzamide |
|---|---|
| PubChem CID | 167275407 |
| Molecular Formula | C36H53N7O3 |
| Molecular Weight | 631.87 g/mol |
| Exact Mass | 631.42 |
| IUPAC Name | N-[3-[4-[2-[[4-(methylaminomethyl)phenyl]methylamino]-2-oxoethoxy]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-1-yl]propyl]-4-[4-methyl-4-(methylamino)pentyl]benzamide |
| SMILES | CNCc1ccc(CNC(=O)COC2CCCCCc3c2nnn3CCCNC(=O)c2ccc(CCCC(C)(C)NC)cc2)cc1 |
| InChI | InChI=1S/C36H53N7O3/c1-36(2,38-4)21-8-10-27-17-19-30(20-18-27)35(45)39-22-9-23-43-31-11-6-5-7-12-32(34(31)41-42-43)46-26-33(44)40-25-29-15-13-28(14-16-29)24-37-3/h13-20,32,37-38H,5-12,21-26H2,1-4H3,(H,39,45)(H,40,44) |
| InChIKey | KENCGOXMMTYADD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.87 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|