C22H27NOS — CID 16727617
5,7-ditert-butyl-2-(4-methylsulfanylphenyl)-1,3-benzoxazole (PubChem CID 16727617) has the molecular formula C22H27NOS and a molecular weight of 353.53 g/mol. Its IUPAC name is 5,7-ditert-butyl-2-(4-methylsulfanylphenyl)-1,3-benzoxazole.
| Compound Name | 5,7-ditert-butyl-2-(4-methylsulfanylphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 16727617 |
| Molecular Formula | C22H27NOS |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 5,7-ditert-butyl-2-(4-methylsulfanylphenyl)-1,3-benzoxazole |
| SMILES | CSc1ccc(-c2nc3cc(C(C)(C)C)cc(C(C)(C)C)c3o2)cc1 |
| InChI | InChI=1S/C22H27NOS/c1-21(2,3)15-12-17(22(4,5)6)19-18(13-15)23-20(24-19)14-8-10-16(25-7)11-9-14/h8-13H,1-7H3 |
| InChIKey | KZFFGCIAUYJKEE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |