About 3-(2-hexyloctyl)pyridine
3-(2-hexyloctyl)pyridine (PubChem CID 167277838) has the molecular formula C19H33N
and a molecular weight of 275.48 g/mol. Its IUPAC name is 3-(2-hexyloctyl)pyridine.
Molecular Properties
| Compound Name | 3-(2-hexyloctyl)pyridine |
| PubChem CID | 167277838 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 3-(2-hexyloctyl)pyridine |
| SMILES | CCCCCCC(CCCCCC)Cc1cccnc1 |
| InChI | InChI=1S/C19H33N/c1-3-5-7-9-12-18(13-10-8-6-4-2)16-19-14-11-15-20-17-19/h11,14-15,17-18H,3-10,12-13,16H2,1-2H3 |
| InChIKey | CQNNZLXDQKJDFG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hexyloctyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hexyloctyl)pyridine?
The IUPAC name of 3-(2-hexyloctyl)pyridine (CID 167277838) is 3-(2-hexyloctyl)pyridine.
What is the SMILES notation for 3-(2-hexyloctyl)pyridine?
The canonical SMILES for 3-(2-hexyloctyl)pyridine is CCCCCCC(CCCCCC)Cc1cccnc1.
What is the InChIKey of 3-(2-hexyloctyl)pyridine?
The InChIKey is CQNNZLXDQKJDFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33N/c1-3-5-7-9-12-18(13-10-8-6-4-2)16-19-14-11-15-20-17-19/h11,14-15,17-18H,3-10,12-13,16H2,1-2H3.
What are the key properties of 3-(2-hexyloctyl)pyridine?
3-(2-hexyloctyl)pyridine has a molecular weight of 275.48 g/mol, XLogP of 6.18, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hexyloctyl)pyridine is sourced from PubChem (CID 167277838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).