About 3-(2-ethylhexyl)pyridine
3-(2-ethylhexyl)pyridine (PubChem CID 57206063) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 3-(2-ethylhexyl)pyridine.
Molecular Properties
| Compound Name | 3-(2-ethylhexyl)pyridine |
| PubChem CID | 57206063 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 3-(2-ethylhexyl)pyridine |
| SMILES | CCCCC(CC)Cc1cccnc1 |
| InChI | InChI=1S/C13H21N/c1-3-5-7-12(4-2)10-13-8-6-9-14-11-13/h6,8-9,11-12H,3-5,7,10H2,1-2H3 |
| InChIKey | MITLYIBKBQKTAJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-ethylhexyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethylhexyl)pyridine?
The IUPAC name of 3-(2-ethylhexyl)pyridine (CID 57206063) is 3-(2-ethylhexyl)pyridine.
What is the SMILES notation for 3-(2-ethylhexyl)pyridine?
The canonical SMILES for 3-(2-ethylhexyl)pyridine is CCCCC(CC)Cc1cccnc1.
What is the InChIKey of 3-(2-ethylhexyl)pyridine?
The InChIKey is MITLYIBKBQKTAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-3-5-7-12(4-2)10-13-8-6-9-14-11-13/h6,8-9,11-12H,3-5,7,10H2,1-2H3.
What are the key properties of 3-(2-ethylhexyl)pyridine?
3-(2-ethylhexyl)pyridine has a molecular weight of 191.32 g/mol, XLogP of 3.84, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethylhexyl)pyridine is sourced from PubChem (CID 57206063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).