C8H16N2O4S — CID 167279552
(3S)-4-amino-3-[(2-hydroxyacetyl)-methylamino]-2-methyl-4-sulfanylbutanoic acid (PubChem CID 167279552) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is (3S)-4-amino-3-[(2-hydroxyacetyl)-methylamino]-2-methyl-4-sulfanylbutanoic acid.
| Compound Name | (3S)-4-amino-3-[(2-hydroxyacetyl)-methylamino]-2-methyl-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 167279552 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (3S)-4-amino-3-[(2-hydroxyacetyl)-methylamino]-2-methyl-4-sulfanylbutanoic acid |
| SMILES | CC(C(=O)O)[C@@H](C(N)S)N(C)C(=O)CO |
| InChI | InChI=1S/C8H16N2O4S/c1-4(8(13)14)6(7(9)15)10(2)5(12)3-11/h4,6-7,11,15H,3,9H2,1-2H3,(H,13,14)/t4?,6-,7?/m0/s1 |
| InChIKey | IHSAYUNUFTWQQG-FSTBSXBUSA-N |
| XLogP | -1.26 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|