C30H41N3O3 — CID 167279962
3-[3-oxo-6-[8-(3-tricyclo[3.3.1.03,7]nonanylamino)octyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167279962) has the molecular formula C30H41N3O3 and a molecular weight of 491.68 g/mol. Its IUPAC name is 3-[3-oxo-6-[8-(3-tricyclo[3.3.1.03,7]nonanylamino)octyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[8-(3-tricyclo[3.3.1.03,7]nonanylamino)octyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167279962 |
| Molecular Formula | C30H41N3O3 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | 3-[3-oxo-6-[8-(3-tricyclo[3.3.1.03,7]nonanylamino)octyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CCCCCCCCNC45CC6CC(CC4C6)C5)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H41N3O3/c34-27-11-10-26(28(35)32-27)33-19-23-14-20(8-9-25(23)29(33)36)7-5-3-1-2-4-6-12-31-30-17-21-13-22(18-30)16-24(30)15-21/h8-9,14,21-22,24,26,31H,1-7,10-13,15-19H2,(H,32,34,35) |
| InChIKey | GVSSEPVWCDJXFG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|