C34H44N4O6 — CID 16728020
(4-nitrophenyl)methyl N-[1-[[(3R,4S)-1-(cyclohexanecarbonyl)-4-hydroxy-4-phenylpyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate (PubChem CID 16728020) has the molecular formula C34H44N4O6 and a molecular weight of 604.75 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-[[(3R,4S)-1-(cyclohexanecarbonyl)-4-hydroxy-4-phenylpyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | (4-nitrophenyl)methyl N-[1-[[(3R,4S)-1-(cyclohexanecarbonyl)-4-hydroxy-4-phenylpyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 16728020 |
| Molecular Formula | C34H44N4O6 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-[[(3R,4S)-1-(cyclohexanecarbonyl)-4-hydroxy-4-phenylpyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(C[C@@H]2CN(C(=O)C3CCCCC3)C[C@@]2(O)c2ccccc2)CC1 |
| InChI | InChI=1S/C34H44N4O6/c1-2-19-37(33(40)44-24-26-13-15-31(16-14-26)38(42)43)30-17-20-35(21-18-30)22-29-23-36(32(39)27-9-5-3-6-10-27)25-34(29,41)28-11-7-4-8-12-28/h2,4,7-8,11-16,27,29-30,41H,1,3,5-6,9-10,17-25H2/t29-,34-/m1/s1 |
| InChIKey | YIUCIHPCMLBLOR-ANHUGMMASA-N |
| XLogP | 5.11 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|