C15H14N2O — CID 16728034
2-(ethylamino)-5H-phenanthridin-6-one (PubChem CID 16728034) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(ethylamino)-5H-phenanthridin-6-one.
| Compound Name | 2-(ethylamino)-5H-phenanthridin-6-one |
|---|---|
| PubChem CID | 16728034 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-(ethylamino)-5H-phenanthridin-6-one |
| SMILES | CCNc1ccc2[nH]c(=O)c3ccccc3c2c1 |
| InChI | InChI=1S/C15H14N2O/c1-2-16-10-7-8-14-13(9-10)11-5-3-4-6-12(11)15(18)17-14/h3-9,16H,2H2,1H3,(H,17,18) |
| InChIKey | FKWUFWGODJQYSU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|