C18H16N3O5- — CID 163892585
[oxido-[2-oxo-2-[(6-oxo-5H-phenanthridin-2-yl)amino]ethyl]amino]methyl acetate (PubChem CID 163892585) has the molecular formula C18H16N3O5- and a molecular weight of 354.34 g/mol. Its IUPAC name is [oxido-[2-oxo-2-[(6-oxo-5H-phenanthridin-2-yl)amino]ethyl]amino]methyl acetate.
| Compound Name | [oxido-[2-oxo-2-[(6-oxo-5H-phenanthridin-2-yl)amino]ethyl]amino]methyl acetate |
|---|---|
| PubChem CID | 163892585 |
| Molecular Formula | C18H16N3O5- |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [oxido-[2-oxo-2-[(6-oxo-5H-phenanthridin-2-yl)amino]ethyl]amino]methyl acetate |
| SMILES | CC(=O)OCN([O-])CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1 |
| InChI | InChI=1S/C18H16N3O5/c1-11(22)26-10-21(25)9-17(23)19-12-6-7-16-15(8-12)13-4-2-3-5-14(13)18(24)20-16/h2-8H,9-10H2,1H3,(H,19,23)(H,20,24)/q-1 |
| InChIKey | IUBCLFOVDMXNOY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|