About 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline
4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline (PubChem CID 16728095) has the molecular formula C18H11F6NO
and a molecular weight of 371.28 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline |
| PubChem CID | 16728095 |
| Molecular Formula | C18H11F6NO |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)cc1 |
| InChI | InChI=1S/C18H11F6NO/c1-26-11-7-5-10(6-8-11)13-9-15(18(22,23)24)25-16-12(13)3-2-4-14(16)17(19,20)21/h2-9H,1H3 |
| InChIKey | HDTWFOXTZQPDGY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline?
The IUPAC name of 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline (CID 16728095) is 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline.
What is the SMILES notation for 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline?
The canonical SMILES for 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline is COc1ccc(-c2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline?
The InChIKey is HDTWFOXTZQPDGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F6NO/c1-26-11-7-5-10(6-8-11)13-9-15(18(22,23)24)25-16-12(13)3-2-4-14(16)17(19,20)21/h2-9H,1H3.
What are the key properties of 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline?
4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline has a molecular weight of 371.28 g/mol, XLogP of 5.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-2,8-bis(trifluoromethyl)quinoline is sourced from PubChem (CID 16728095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).