C24H22F6N2O — CID 16728112
(S)-[(2S)-1-benzylpiperidin-2-yl]-[2,8-bis(trifluoromethyl)quinolin-4-yl]methanol (PubChem CID 16728112) has the molecular formula C24H22F6N2O and a molecular weight of 468.44 g/mol. Its IUPAC name is (S)-[(2S)-1-benzylpiperidin-2-yl]-[2,8-bis(trifluoromethyl)quinolin-4-yl]methanol.
| Compound Name | (S)-[(2S)-1-benzylpiperidin-2-yl]-[2,8-bis(trifluoromethyl)quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 16728112 |
| Molecular Formula | C24H22F6N2O |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (S)-[(2S)-1-benzylpiperidin-2-yl]-[2,8-bis(trifluoromethyl)quinolin-4-yl]methanol |
| SMILES | O[C@@H](c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)[C@@H]1CCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C24H22F6N2O/c25-23(26,27)18-10-6-9-16-17(13-20(24(28,29)30)31-21(16)18)22(33)19-11-4-5-12-32(19)14-15-7-2-1-3-8-15/h1-3,6-10,13,19,22,33H,4-5,11-12,14H2/t19-,22-/m0/s1 |
| InChIKey | DLGOATJBLFNFSJ-UGKGYDQZSA-N |
| XLogP | 6.36 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |