C20H20F6N2O — CID 16728113
(S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2S)-1-prop-2-enylpiperidin-2-yl]methanol (PubChem CID 16728113) has the molecular formula C20H20F6N2O and a molecular weight of 418.38 g/mol. Its IUPAC name is (S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2S)-1-prop-2-enylpiperidin-2-yl]methanol.
| Compound Name | (S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2S)-1-prop-2-enylpiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 16728113 |
| Molecular Formula | C20H20F6N2O |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2S)-1-prop-2-enylpiperidin-2-yl]methanol |
| SMILES | C=CCN1CCCC[C@H]1[C@@H](O)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C20H20F6N2O/c1-2-9-28-10-4-3-8-15(28)18(29)13-11-16(20(24,25)26)27-17-12(13)6-5-7-14(17)19(21,22)23/h2,5-7,11,15,18,29H,1,3-4,8-10H2/t15-,18-/m0/s1 |
| InChIKey | NTSLLAQENLGVQY-YJBOKZPZSA-N |
| XLogP | 5.35 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|