C13H19F3N4O6 — CID 16728129
(1R,3R,4S)-3-[1-acetamido-2-(2,2,2-trifluoroacetyl)oxyethyl]-4-(diaminomethylideneamino)-1-hydroxycyclopentane-1-carboxylic acid (PubChem CID 16728129) has the molecular formula C13H19F3N4O6 and a molecular weight of 384.31 g/mol. Its IUPAC name is (1R,3R,4S)-3-[1-acetamido-2-(2,2,2-trifluoroacetyl)oxyethyl]-4-(diaminomethylideneamino)-1-hydroxycyclopentane-1-carboxylic acid.
| Compound Name | (1R,3R,4S)-3-[1-acetamido-2-(2,2,2-trifluoroacetyl)oxyethyl]-4-(diaminomethylideneamino)-1-hydroxycyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 16728129 |
| Molecular Formula | C13H19F3N4O6 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (1R,3R,4S)-3-[1-acetamido-2-(2,2,2-trifluoroacetyl)oxyethyl]-4-(diaminomethylideneamino)-1-hydroxycyclopentane-1-carboxylic acid |
| SMILES | CC(=O)NC(COC(=O)C(F)(F)F)[C@H]1C[C@](O)(C(=O)O)C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C13H19F3N4O6/c1-5(21)19-8(4-26-10(24)13(14,15)16)6-2-12(25,9(22)23)3-7(6)20-11(17)18/h6-8,25H,2-4H2,1H3,(H,19,21)(H,22,23)(H4,17,18,20)/t6-,7-,8?,12+/m0/s1 |
| InChIKey | NHRGJDPJEDPERI-HQTAMEHYSA-N |
| XLogP | -1.54 |
| TPSA | 177.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|