C26H22BrClN6O2S — CID 16728264
4-[[2-[[5-bromo-4-(4-ethylnaphthalen-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-chloro-N-(2-cyanoethyl)benzamide (PubChem CID 16728264) has the molecular formula C26H22BrClN6O2S and a molecular weight of 597.93 g/mol. Its IUPAC name is 4-[[2-[[5-bromo-4-(4-ethylnaphthalen-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-chloro-N-(2-cyanoethyl)benzamide.
| Compound Name | 4-[[2-[[5-bromo-4-(4-ethylnaphthalen-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-chloro-N-(2-cyanoethyl)benzamide |
|---|---|
| PubChem CID | 16728264 |
| Molecular Formula | C26H22BrClN6O2S |
| Molecular Weight | 597.93 g/mol |
| Exact Mass | 596.04 |
| IUPAC Name | 4-[[2-[[5-bromo-4-(4-ethylnaphthalen-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-chloro-N-(2-cyanoethyl)benzamide |
| SMILES | CCc1ccc(-n2c(Br)nnc2SCC(=O)Nc2ccc(C(=O)NCCC#N)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C26H22BrClN6O2S/c1-2-16-9-11-22(19-7-4-3-6-18(16)19)34-25(27)32-33-26(34)37-15-23(35)31-21-10-8-17(14-20(21)28)24(36)30-13-5-12-29/h3-4,6-11,14H,2,5,13,15H2,1H3,(H,30,36)(H,31,35) |
| InChIKey | UHFOBJDBEXGVAO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.93 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|