About 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline
4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline (PubChem CID 167284416) has the molecular formula C20H20ClNO3S
and a molecular weight of 389.90 g/mol. Its IUPAC name is 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline.
Molecular Properties
| Compound Name | 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline |
| PubChem CID | 167284416 |
| Molecular Formula | C20H20ClNO3S |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline |
| SMILES | COc1cc2ncc(CCOc3ccc(SC)cc3)c(Cl)c2cc1OC |
| InChI | InChI=1S/C20H20ClNO3S/c1-23-18-10-16-17(11-19(18)24-2)22-12-13(20(16)21)8-9-25-14-4-6-15(26-3)7-5-14/h4-7,10-12H,8-9H2,1-3H3 |
| InChIKey | XEMCBQJLWURLLX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline?
The IUPAC name of 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline (CID 167284416) is 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline.
What is the SMILES notation for 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline?
The canonical SMILES for 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline is COc1cc2ncc(CCOc3ccc(SC)cc3)c(Cl)c2cc1OC.
What is the InChIKey of 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline?
The InChIKey is XEMCBQJLWURLLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClNO3S/c1-23-18-10-16-17(11-19(18)24-2)22-12-13(20(16)21)8-9-25-14-4-6-15(26-3)7-5-14/h4-7,10-12H,8-9H2,1-3H3.
What are the key properties of 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline?
4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline has a molecular weight of 389.90 g/mol, XLogP of 5.25, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,7-dimethoxy-3-[2-(4-methylsulfanylphenoxy)ethyl]quinoline is sourced from PubChem (CID 167284416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).