C13H27NO — CID 167286706
N-(2-tert-butyl-3,3-dimethylpentyl)-N-methylformamide (PubChem CID 167286706) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is N-(2-tert-butyl-3,3-dimethylpentyl)-N-methylformamide.
| Compound Name | N-(2-tert-butyl-3,3-dimethylpentyl)-N-methylformamide |
|---|---|
| PubChem CID | 167286706 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N-(2-tert-butyl-3,3-dimethylpentyl)-N-methylformamide |
| SMILES | CCC(C)(C)C(CN(C)C=O)C(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-8-13(5,6)11(12(2,3)4)9-14(7)10-15/h10-11H,8-9H2,1-7H3 |
| InChIKey | LXBTYNOBOIKIRU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|