C13H28F3NO — CID 178007361
ethane;N-methyl-N-(5-methylhexyl)formamide;1,1,1-trifluoroethane (PubChem CID 178007361) has the molecular formula C13H28F3NO and a molecular weight of 271.37 g/mol. Its IUPAC name is ethane;N-methyl-N-(5-methylhexyl)formamide;1,1,1-trifluoroethane.
| Compound Name | ethane;N-methyl-N-(5-methylhexyl)formamide;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 178007361 |
| Molecular Formula | C13H28F3NO |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | ethane;N-methyl-N-(5-methylhexyl)formamide;1,1,1-trifluoroethane |
| SMILES | CC.CC(C)CCCCN(C)C=O.CC(F)(F)F |
| InChI | InChI=1S/C9H19NO.C2H3F3.C2H6/c1-9(2)6-4-5-7-10(3)8-11;1-2(3,4)5;1-2/h8-9H,4-7H2,1-3H3;1H3;1-2H3 |
| InChIKey | DQTGHWJWPHTXAZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|