C17H37NO — CID 167289197
N-tert-butyl-N-(10,10-dimethylundecan-4-yl)hydroxylamine (PubChem CID 167289197) has the molecular formula C17H37NO and a molecular weight of 271.49 g/mol. Its IUPAC name is N-tert-butyl-N-(10,10-dimethylundecan-4-yl)hydroxylamine.
| Compound Name | N-tert-butyl-N-(10,10-dimethylundecan-4-yl)hydroxylamine |
|---|---|
| PubChem CID | 167289197 |
| Molecular Formula | C17H37NO |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.29 |
| IUPAC Name | N-tert-butyl-N-(10,10-dimethylundecan-4-yl)hydroxylamine |
| SMILES | CCCC(CCCCCC(C)(C)C)N(O)C(C)(C)C |
| InChI | InChI=1S/C17H37NO/c1-8-12-15(18(19)17(5,6)7)13-10-9-11-14-16(2,3)4/h15,19H,8-14H2,1-7H3 |
| InChIKey | WZVIGKWJUBQSRE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|