C18H27NO2S — CID 167289690
(2,6-diethylphenyl) 2-(2,3-dimethylthiomorpholin-4-yl)acetate (PubChem CID 167289690) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is (2,6-diethylphenyl) 2-(2,3-dimethylthiomorpholin-4-yl)acetate.
| Compound Name | (2,6-diethylphenyl) 2-(2,3-dimethylthiomorpholin-4-yl)acetate |
|---|---|
| PubChem CID | 167289690 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (2,6-diethylphenyl) 2-(2,3-dimethylthiomorpholin-4-yl)acetate |
| SMILES | CCc1cccc(CC)c1OC(=O)CN1CCSC(C)C1C |
| InChI | InChI=1S/C18H27NO2S/c1-5-15-8-7-9-16(6-2)18(15)21-17(20)12-19-10-11-22-14(4)13(19)3/h7-9,13-14H,5-6,10-12H2,1-4H3 |
| InChIKey | LKASKANTXCAHSW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|