C9H10N4O3S — CID 16729004
4-[4-(hydroxymethyl)triazol-1-yl]benzenesulfonamide (PubChem CID 16729004) has the molecular formula C9H10N4O3S and a molecular weight of 254.27 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)triazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-(hydroxymethyl)triazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 16729004 |
| Molecular Formula | C9H10N4O3S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 4-[4-(hydroxymethyl)triazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2cc(CO)nn2)cc1 |
| InChI | InChI=1S/C9H10N4O3S/c10-17(15,16)9-3-1-8(2-4-9)13-5-7(6-14)11-12-13/h1-5,14H,6H2,(H2,10,15,16) |
| InChIKey | IIQIBRLYHGPETH-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |