C18H35NO — CID 167290572
1-(3,5-dimethylazepan-1-yl)-2-methyl-2-propylhexan-1-one (PubChem CID 167290572) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is 1-(3,5-dimethylazepan-1-yl)-2-methyl-2-propylhexan-1-one.
| Compound Name | 1-(3,5-dimethylazepan-1-yl)-2-methyl-2-propylhexan-1-one |
|---|---|
| PubChem CID | 167290572 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | 1-(3,5-dimethylazepan-1-yl)-2-methyl-2-propylhexan-1-one |
| SMILES | CCCCC(C)(CCC)C(=O)N1CCC(C)CC(C)C1 |
| InChI | InChI=1S/C18H35NO/c1-6-8-11-18(5,10-7-2)17(20)19-12-9-15(3)13-16(4)14-19/h15-16H,6-14H2,1-5H3 |
| InChIKey | SRNDWUJOCRELIQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |