C25H27N3O6 — CID 167290582
methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-6-[(3-methyl-1-benzofuran-2-carbonyl)amino]-7-oxohept-2-enoate (PubChem CID 167290582) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-6-[(3-methyl-1-benzofuran-2-carbonyl)amino]-7-oxohept-2-enoate.
| Compound Name | methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-6-[(3-methyl-1-benzofuran-2-carbonyl)amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 167290582 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | methyl (E)-7-[(1-ethyl-2-oxo-3-pyridinyl)amino]-6-[(3-methyl-1-benzofuran-2-carbonyl)amino]-7-oxohept-2-enoate |
| SMILES | CCn1cccc(NC(=O)C(CC/C=C/C(=O)OC)NC(=O)c2oc3ccccc3c2C)c1=O |
| InChI | InChI=1S/C25H27N3O6/c1-4-28-15-9-12-19(25(28)32)27-23(30)18(11-6-8-14-21(29)33-3)26-24(31)22-16(2)17-10-5-7-13-20(17)34-22/h5,7-10,12-15,18H,4,6,11H2,1-3H3,(H,26,31)(H,27,30)/b14-8+ |
| InChIKey | FWEURZDBZDONLN-RIYZIHGNSA-N |
| XLogP | 3.17 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|