C35H42N4O7 — CID 167290306
methyl (E,6S)-6-[(3-methyl-1-benzofuran-2-carbonyl)amino]-7-oxo-7-[[2-oxo-1-[2-oxo-2-[[(1R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]amino]hept-2-enoate (PubChem CID 167290306) has the molecular formula C35H42N4O7 and a molecular weight of 630.74 g/mol. Its IUPAC name is methyl (E,6S)-6-[(3-methyl-1-benzofuran-2-carbonyl)amino]-7-oxo-7-[[2-oxo-1-[2-oxo-2-[[(1R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]amino]hept-2-enoate.
| Compound Name | methyl (E,6S)-6-[(3-methyl-1-benzofuran-2-carbonyl)amino]-7-oxo-7-[[2-oxo-1-[2-oxo-2-[[(1R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]amino]hept-2-enoate |
|---|---|
| PubChem CID | 167290306 |
| Molecular Formula | C35H42N4O7 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | methyl (E,6S)-6-[(3-methyl-1-benzofuran-2-carbonyl)amino]-7-oxo-7-[[2-oxo-1-[2-oxo-2-[[(1R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]amino]hept-2-enoate |
| SMILES | COC(=O)/C=C/CC[C@H](NC(=O)c1oc2ccccc2c1C)C(=O)Nc1cccn(CC(=O)NC2CC3CC[C@]2(C)C3(C)C)c1=O |
| InChI | InChI=1S/C35H42N4O7/c1-21-23-11-6-8-14-26(23)46-30(21)32(43)36-24(12-7-9-15-29(41)45-5)31(42)37-25-13-10-18-39(33(25)44)20-28(40)38-27-19-22-16-17-35(27,4)34(22,2)3/h6,8-11,13-15,18,22,24,27H,7,12,16-17,19-20H2,1-5H3,(H,36,43)(H,37,42)(H,38,40)/b15-9+/t22?,24-,27?,35-/m0/s1 |
| InChIKey | BIMQCHBUHPGDAD-JAFWYRHCSA-N |
| XLogP | 4.48 |
| TPSA | 148.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|