C33H39N5O7 — CID 166455651
(5S)-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]-2-oxo-N'-[2-oxo-1-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]hexanediamide (PubChem CID 166455651) has the molecular formula C33H39N5O7 and a molecular weight of 617.70 g/mol. Its IUPAC name is (5S)-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]-2-oxo-N'-[2-oxo-1-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]hexanediamide.
| Compound Name | (5S)-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]-2-oxo-N'-[2-oxo-1-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]hexanediamide |
|---|---|
| PubChem CID | 166455651 |
| Molecular Formula | C33H39N5O7 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | (5S)-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]-2-oxo-N'-[2-oxo-1-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]hexanediamide |
| SMILES | Cc1c(C(=O)N[C@@H](CCC(=O)C(N)=O)C(=O)Nc2cccn(CC(=O)N[C@H]3C[C@H]4CC[C@]3(C)C4(C)C)c2=O)oc2ccccc12 |
| InChI | InChI=1S/C33H39N5O7/c1-18-20-8-5-6-10-24(20)45-27(18)30(43)35-21(11-12-23(39)28(34)41)29(42)36-22-9-7-15-38(31(22)44)17-26(40)37-25-16-19-13-14-33(25,4)32(19,2)3/h5-10,15,19,21,25H,11-14,16-17H2,1-4H3,(H2,34,41)(H,35,43)(H,36,42)(H,37,40)/t19-,21+,25+,33+/m1/s1 |
| InChIKey | FQHOMGIXJRWGOI-VUJJUSPDSA-N |
| XLogP | 2.81 |
| TPSA | 182.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|