C32H37N5O7 — CID 166455838
(5S)-5-(1-benzofuran-2-carbonylamino)-2-oxo-N'-[2-oxo-1-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]hexanediamide (PubChem CID 166455838) has the molecular formula C32H37N5O7 and a molecular weight of 603.68 g/mol. Its IUPAC name is (5S)-5-(1-benzofuran-2-carbonylamino)-2-oxo-N'-[2-oxo-1-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]hexanediamide.
| Compound Name | (5S)-5-(1-benzofuran-2-carbonylamino)-2-oxo-N'-[2-oxo-1-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]hexanediamide |
|---|---|
| PubChem CID | 166455838 |
| Molecular Formula | C32H37N5O7 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | (5S)-5-(1-benzofuran-2-carbonylamino)-2-oxo-N'-[2-oxo-1-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]-3-pyridinyl]hexanediamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](NC(=O)Cn1cccc(NC(=O)[C@H](CCC(=O)C(N)=O)NC(=O)c3cc4ccccc4o3)c1=O)C2 |
| InChI | InChI=1S/C32H37N5O7/c1-31(2)19-12-13-32(31,3)25(16-19)36-26(39)17-37-14-6-8-21(30(37)43)35-28(41)20(10-11-22(38)27(33)40)34-29(42)24-15-18-7-4-5-9-23(18)44-24/h4-9,14-15,19-20,25H,10-13,16-17H2,1-3H3,(H2,33,40)(H,34,42)(H,35,41)(H,36,39)/t19-,20+,25+,32+/m1/s1 |
| InChIKey | VSNZBKYYOOJVBK-CAXFEEOMSA-N |
| XLogP | 2.50 |
| TPSA | 182.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|