C29H34ClN5O6S — CID 166455934
(2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(5-chlorothiophene-3-carbonyl)amino]-N'-methyl-5-oxohexanediamide (PubChem CID 166455934) has the molecular formula C29H34ClN5O6S and a molecular weight of 616.14 g/mol. Its IUPAC name is (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(5-chlorothiophene-3-carbonyl)amino]-N'-methyl-5-oxohexanediamide.
| Compound Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(5-chlorothiophene-3-carbonyl)amino]-N'-methyl-5-oxohexanediamide |
|---|---|
| PubChem CID | 166455934 |
| Molecular Formula | C29H34ClN5O6S |
| Molecular Weight | 616.14 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(5-chlorothiophene-3-carbonyl)amino]-N'-methyl-5-oxohexanediamide |
| SMILES | CNC(=O)C(=O)CC[C@H](NC(=O)c1csc(Cl)c1)C(=O)Nc1cccn(CC(=O)NC2C3CC4CC(C3)CC2C4)c1=O |
| InChI | InChI=1S/C29H34ClN5O6S/c1-31-28(40)22(36)5-4-20(32-26(38)19-12-23(30)42-14-19)27(39)33-21-3-2-6-35(29(21)41)13-24(37)34-25-17-8-15-7-16(10-17)11-18(25)9-15/h2-3,6,12,14-18,20,25H,4-5,7-11,13H2,1H3,(H,31,40)(H,32,38)(H,33,39)(H,34,37)/t15?,16?,17?,18?,20-,25?/m0/s1 |
| InChIKey | SJJXATULNPTFQV-SVILIYSKSA-N |
| XLogP | 2.34 |
| TPSA | 155.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.14 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|