C29H37N7O6 — CID 167286606
(2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-methyl-2-[(1-methylpyrazole-4-carbonyl)amino]-5-oxohexanediamide (PubChem CID 167286606) has the molecular formula C29H37N7O6 and a molecular weight of 579.66 g/mol. Its IUPAC name is (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-methyl-2-[(1-methylpyrazole-4-carbonyl)amino]-5-oxohexanediamide.
| Compound Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-methyl-2-[(1-methylpyrazole-4-carbonyl)amino]-5-oxohexanediamide |
|---|---|
| PubChem CID | 167286606 |
| Molecular Formula | C29H37N7O6 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-methyl-2-[(1-methylpyrazole-4-carbonyl)amino]-5-oxohexanediamide |
| SMILES | CNC(=O)C(=O)CC[C@H](NC(=O)c1cnn(C)c1)C(=O)Nc1cccn(CC(=O)NC2C3CC4CC(C3)CC2C4)c1=O |
| InChI | InChI=1S/C29H37N7O6/c1-30-28(41)23(37)6-5-21(32-26(39)20-13-31-35(2)14-20)27(40)33-22-4-3-7-36(29(22)42)15-24(38)34-25-18-9-16-8-17(11-18)12-19(25)10-16/h3-4,7,13-14,16-19,21,25H,5-6,8-12,15H2,1-2H3,(H,30,41)(H,32,39)(H,33,40)(H,34,38)/t16?,17?,18?,19?,21-,25?/m0/s1 |
| InChIKey | XBOHFUITVQGUBR-YTAQNGHSSA-N |
| XLogP | 0.36 |
| TPSA | 173.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|