C30H36BrN5O6S — CID 166455821
(2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(5-bromo-3-methylthiophene-2-carbonyl)amino]-N'-methyl-5-oxohexanediamide (PubChem CID 166455821) has the molecular formula C30H36BrN5O6S and a molecular weight of 674.62 g/mol. Its IUPAC name is (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(5-bromo-3-methylthiophene-2-carbonyl)amino]-N'-methyl-5-oxohexanediamide.
| Compound Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(5-bromo-3-methylthiophene-2-carbonyl)amino]-N'-methyl-5-oxohexanediamide |
|---|---|
| PubChem CID | 166455821 |
| Molecular Formula | C30H36BrN5O6S |
| Molecular Weight | 674.62 g/mol |
| Exact Mass | 673.16 |
| IUPAC Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(5-bromo-3-methylthiophene-2-carbonyl)amino]-N'-methyl-5-oxohexanediamide |
| SMILES | CNC(=O)C(=O)CC[C@H](NC(=O)c1sc(Br)cc1C)C(=O)Nc1cccn(CC(=O)NC2C3CC4CC(C3)CC2C4)c1=O |
| InChI | InChI=1S/C30H36BrN5O6S/c1-15-8-23(31)43-26(15)29(41)33-20(5-6-22(37)28(40)32-2)27(39)34-21-4-3-7-36(30(21)42)14-24(38)35-25-18-10-16-9-17(12-18)13-19(25)11-16/h3-4,7-8,16-20,25H,5-6,9-14H2,1-2H3,(H,32,40)(H,33,41)(H,34,39)(H,35,38)/t16?,17?,18?,19?,20-,25?/m0/s1 |
| InChIKey | CFNIZGOEPLDWIX-KEBNJSOGSA-N |
| XLogP | 2.75 |
| TPSA | 155.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.62 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|