C30H44N6O6 — CID 166455745
(2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[[2-(butylamino)acetyl]amino]-N'-methyl-5-oxohexanediamide (PubChem CID 166455745) has the molecular formula C30H44N6O6 and a molecular weight of 584.72 g/mol. Its IUPAC name is (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[[2-(butylamino)acetyl]amino]-N'-methyl-5-oxohexanediamide.
| Compound Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[[2-(butylamino)acetyl]amino]-N'-methyl-5-oxohexanediamide |
|---|---|
| PubChem CID | 166455745 |
| Molecular Formula | C30H44N6O6 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[[2-(butylamino)acetyl]amino]-N'-methyl-5-oxohexanediamide |
| SMILES | CCCCNCC(=O)N[C@@H](CCC(=O)C(=O)NC)C(=O)Nc1cccn(CC(=O)NC2C3CC4CC(C3)CC2C4)c1=O |
| InChI | InChI=1S/C30H44N6O6/c1-3-4-9-32-16-25(38)33-22(7-8-24(37)29(41)31-2)28(40)34-23-6-5-10-36(30(23)42)17-26(39)35-27-20-12-18-11-19(14-20)15-21(27)13-18/h5-6,10,18-22,27,32H,3-4,7-9,11-17H2,1-2H3,(H,31,41)(H,33,38)(H,34,40)(H,35,39)/t18?,19?,20?,21?,22-,27?/m0/s1 |
| InChIKey | YJEQCZGPGNVQNH-SHXSIGCVSA-N |
| XLogP | 0.70 |
| TPSA | 167.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|