C32H49N5O6 — CID 168932447
methyl (E,6S)-6-[[2-(butylamino)acetyl]amino]-7-[[1-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate (PubChem CID 168932447) has the molecular formula C32H49N5O6 and a molecular weight of 599.77 g/mol. Its IUPAC name is methyl (E,6S)-6-[[2-(butylamino)acetyl]amino]-7-[[1-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate.
| Compound Name | methyl (E,6S)-6-[[2-(butylamino)acetyl]amino]-7-[[1-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 168932447 |
| Molecular Formula | C32H49N5O6 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.37 |
| IUPAC Name | methyl (E,6S)-6-[[2-(butylamino)acetyl]amino]-7-[[1-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate |
| SMILES | CCCCNCC(=O)N[C@@H](CC/C=C/C(=O)OC)C(=O)Nc1cccn(CC(=O)NC2C(C)CC3CC(C)CC2C3)c1=O |
| InChI | InChI=1S/C32H49N5O6/c1-5-6-13-33-19-27(38)34-25(10-7-8-12-29(40)43-4)31(41)35-26-11-9-14-37(32(26)42)20-28(39)36-30-22(3)17-23-15-21(2)16-24(30)18-23/h8-9,11-12,14,21-25,30,33H,5-7,10,13,15-20H2,1-4H3,(H,34,38)(H,35,41)(H,36,39)/b12-8+/t21?,22?,23?,24?,25-,30?/m0/s1 |
| InChIKey | ZAQZNTARSUYRTN-ANOHPFMPSA-N |
| XLogP | 2.75 |
| TPSA | 147.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|