C35H41F2N5O6 — CID 166455030
methyl (E,6S)-6-[(4,5-difluoro-1H-indole-2-carbonyl)amino]-7-[[1-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate (PubChem CID 166455030) has the molecular formula C35H41F2N5O6 and a molecular weight of 665.74 g/mol. Its IUPAC name is methyl (E,6S)-6-[(4,5-difluoro-1H-indole-2-carbonyl)amino]-7-[[1-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate.
| Compound Name | methyl (E,6S)-6-[(4,5-difluoro-1H-indole-2-carbonyl)amino]-7-[[1-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 166455030 |
| Molecular Formula | C35H41F2N5O6 |
| Molecular Weight | 665.74 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | methyl (E,6S)-6-[(4,5-difluoro-1H-indole-2-carbonyl)amino]-7-[[1-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate |
| SMILES | COC(=O)/C=C/CC[C@H](NC(=O)c1cc2c(F)c(F)ccc2[nH]1)C(=O)Nc1cccn(CC(=O)NC2C(C)CC3CC(C)CC2C3)c1=O |
| InChI | InChI=1S/C35H41F2N5O6/c1-19-13-21-15-20(2)32(22(14-19)16-21)41-29(43)18-42-12-6-8-27(35(42)47)40-33(45)26(7-4-5-9-30(44)48-3)39-34(46)28-17-23-25(38-28)11-10-24(36)31(23)37/h5-6,8-12,17,19-22,26,32,38H,4,7,13-16,18H2,1-3H3,(H,39,46)(H,40,45)(H,41,43)/b9-5+/t19?,20?,21?,22?,26-,32?/m0/s1 |
| InChIKey | YDSVMSRFXOTIGO-SRORYUGRSA-N |
| XLogP | 4.43 |
| TPSA | 151.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.74 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|