C34H42N6O6 — CID 168932499
N-methyladamantan-2-amine;methyl (E,6S)-6-(1H-benzimidazole-2-carbonylamino)-7-oxo-7-[[2-oxo-1-(2-oxoethyl)-3-pyridinyl]amino]hept-2-enoate (PubChem CID 168932499) has the molecular formula C34H42N6O6 and a molecular weight of 630.75 g/mol. Its IUPAC name is N-methyladamantan-2-amine;methyl (E,6S)-6-(1H-benzimidazole-2-carbonylamino)-7-oxo-7-[[2-oxo-1-(2-oxoethyl)-3-pyridinyl]amino]hept-2-enoate.
| Compound Name | N-methyladamantan-2-amine;methyl (E,6S)-6-(1H-benzimidazole-2-carbonylamino)-7-oxo-7-[[2-oxo-1-(2-oxoethyl)-3-pyridinyl]amino]hept-2-enoate |
|---|---|
| PubChem CID | 168932499 |
| Molecular Formula | C34H42N6O6 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | N-methyladamantan-2-amine;methyl (E,6S)-6-(1H-benzimidazole-2-carbonylamino)-7-oxo-7-[[2-oxo-1-(2-oxoethyl)-3-pyridinyl]amino]hept-2-enoate |
| SMILES | CNC1C2CC3CC(C2)CC1C3.COC(=O)/C=C/CC[C@H](NC(=O)c1nc2ccccc2[nH]1)C(=O)Nc1cccn(CC=O)c1=O |
| InChI | InChI=1S/C23H23N5O6.C11H19N/c1-34-19(30)11-5-4-9-17(21(31)27-18-10-6-12-28(13-14-29)23(18)33)26-22(32)20-24-15-7-2-3-8-16(15)25-20;1-12-11-9-3-7-2-8(5-9)6-10(11)4-7/h2-3,5-8,10-12,14,17H,4,9,13H2,1H3,(H,24,25)(H,26,32)(H,27,31);7-12H,2-6H2,1H3/b11-5+;/t17-;/m0./s1 |
| InChIKey | DMODPGLOVIMWLK-KMOWTQAMSA-N |
| XLogP | 3.20 |
| TPSA | 164.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|