C23H23N5O6 — CID 166454975
methyl (E,6S)-6-(1H-benzimidazole-2-carbonylamino)-7-oxo-7-[[2-oxo-1-(2-oxoethyl)-3-pyridinyl]amino]hept-2-enoate (PubChem CID 166454975) has the molecular formula C23H23N5O6 and a molecular weight of 465.47 g/mol. Its IUPAC name is methyl (E,6S)-6-(1H-benzimidazole-2-carbonylamino)-7-oxo-7-[[2-oxo-1-(2-oxoethyl)-3-pyridinyl]amino]hept-2-enoate.
| Compound Name | methyl (E,6S)-6-(1H-benzimidazole-2-carbonylamino)-7-oxo-7-[[2-oxo-1-(2-oxoethyl)-3-pyridinyl]amino]hept-2-enoate |
|---|---|
| PubChem CID | 166454975 |
| Molecular Formula | C23H23N5O6 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | methyl (E,6S)-6-(1H-benzimidazole-2-carbonylamino)-7-oxo-7-[[2-oxo-1-(2-oxoethyl)-3-pyridinyl]amino]hept-2-enoate |
| SMILES | COC(=O)/C=C/CC[C@H](NC(=O)c1nc2ccccc2[nH]1)C(=O)Nc1cccn(CC=O)c1=O |
| InChI | InChI=1S/C23H23N5O6/c1-34-19(30)11-5-4-9-17(21(31)27-18-10-6-12-28(13-14-29)23(18)33)26-22(32)20-24-15-7-2-3-8-16(15)25-20/h2-3,5-8,10-12,14,17H,4,9,13H2,1H3,(H,24,25)(H,26,32)(H,27,31)/b11-5+/t17-/m0/s1 |
| InChIKey | KHFYXJXLXKJKRO-RIWGIVCCSA-N |
| XLogP | 1.17 |
| TPSA | 152.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|