C28H37N5O6 — CID 123514629
methyl 6-[(2-aminobenzoyl)amino]-7-[[1-[2-(2-ethylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate (PubChem CID 123514629) has the molecular formula C28H37N5O6 and a molecular weight of 539.63 g/mol. Its IUPAC name is methyl 6-[(2-aminobenzoyl)amino]-7-[[1-[2-(2-ethylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate.
| Compound Name | methyl 6-[(2-aminobenzoyl)amino]-7-[[1-[2-(2-ethylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 123514629 |
| Molecular Formula | C28H37N5O6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | methyl 6-[(2-aminobenzoyl)amino]-7-[[1-[2-(2-ethylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate |
| SMILES | CCC(CC)CNC(=O)Cn1cccc(NC(=O)C(CCC=CC(=O)OC)NC(=O)c2ccccc2N)c1=O |
| InChI | InChI=1S/C28H37N5O6/c1-4-19(5-2)17-30-24(34)18-33-16-10-14-23(28(33)38)32-27(37)22(13-8-9-15-25(35)39-3)31-26(36)20-11-6-7-12-21(20)29/h6-7,9-12,14-16,19,22H,4-5,8,13,17-18,29H2,1-3H3,(H,30,34)(H,31,36)(H,32,37) |
| InChIKey | LQUGIWAAJKUQMI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 161.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|