C33H42Cl2N4O6S — CID 167290766
methyl (E,6S)-6-[(2,5-dichlorothiophene-3-carbonyl)amino]-7-oxo-7-[[2-oxo-1-[2-oxo-2-[(3,3,7,7-tetramethyl-1-bicyclo[3.3.1]nonanyl)amino]ethyl]-3-pyridinyl]amino]hept-2-enoate (PubChem CID 167290766) has the molecular formula C33H42Cl2N4O6S and a molecular weight of 693.69 g/mol. Its IUPAC name is methyl (E,6S)-6-[(2,5-dichlorothiophene-3-carbonyl)amino]-7-oxo-7-[[2-oxo-1-[2-oxo-2-[(3,3,7,7-tetramethyl-1-bicyclo[3.3.1]nonanyl)amino]ethyl]-3-pyridinyl]amino]hept-2-enoate.
| Compound Name | methyl (E,6S)-6-[(2,5-dichlorothiophene-3-carbonyl)amino]-7-oxo-7-[[2-oxo-1-[2-oxo-2-[(3,3,7,7-tetramethyl-1-bicyclo[3.3.1]nonanyl)amino]ethyl]-3-pyridinyl]amino]hept-2-enoate |
|---|---|
| PubChem CID | 167290766 |
| Molecular Formula | C33H42Cl2N4O6S |
| Molecular Weight | 693.69 g/mol |
| Exact Mass | 692.22 |
| IUPAC Name | methyl (E,6S)-6-[(2,5-dichlorothiophene-3-carbonyl)amino]-7-oxo-7-[[2-oxo-1-[2-oxo-2-[(3,3,7,7-tetramethyl-1-bicyclo[3.3.1]nonanyl)amino]ethyl]-3-pyridinyl]amino]hept-2-enoate |
| SMILES | COC(=O)/C=C/CC[C@H](NC(=O)c1cc(Cl)sc1Cl)C(=O)Nc1cccn(CC(=O)NC23CC(CC(C)(C)C2)CC(C)(C)C3)c1=O |
| InChI | InChI=1S/C33H42Cl2N4O6S/c1-31(2)14-20-15-32(3,4)19-33(16-20,18-31)38-25(40)17-39-12-8-10-23(30(39)44)37-29(43)22(9-6-7-11-26(41)45-5)36-28(42)21-13-24(34)46-27(21)35/h7-8,10-13,20,22H,6,9,14-19H2,1-5H3,(H,36,42)(H,37,43)(H,38,40)/b11-7+/t20?,22-,33?/m0/s1 |
| InChIKey | QGKUMTHBGRDJCN-MFESZCDGSA-N |
| XLogP | 5.96 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.69 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|