C33H46N6O6 — CID 170188454
N-[(E,2S)-7-hydroxy-7-methoxy-1-oxo-1-[[2-oxo-1-[2-oxo-2-[(3,5,7-trimethyl-1-adamantyl)amino]ethyl]-3-pyridinyl]amino]hept-5-en-2-yl]-3-methylimidazole-4-carboxamide (PubChem CID 170188454) has the molecular formula C33H46N6O6 and a molecular weight of 622.77 g/mol. Its IUPAC name is N-[(E,2S)-7-hydroxy-7-methoxy-1-oxo-1-[[2-oxo-1-[2-oxo-2-[(3,5,7-trimethyl-1-adamantyl)amino]ethyl]-3-pyridinyl]amino]hept-5-en-2-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[(E,2S)-7-hydroxy-7-methoxy-1-oxo-1-[[2-oxo-1-[2-oxo-2-[(3,5,7-trimethyl-1-adamantyl)amino]ethyl]-3-pyridinyl]amino]hept-5-en-2-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 170188454 |
| Molecular Formula | C33H46N6O6 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.35 |
| IUPAC Name | N-[(E,2S)-7-hydroxy-7-methoxy-1-oxo-1-[[2-oxo-1-[2-oxo-2-[(3,5,7-trimethyl-1-adamantyl)amino]ethyl]-3-pyridinyl]amino]hept-5-en-2-yl]-3-methylimidazole-4-carboxamide |
| SMILES | COC(O)/C=C/CC[C@H](NC(=O)c1cncn1C)C(=O)Nc1cccn(CC(=O)NC23CC4(C)CC(C)(CC(C)(C4)C2)C3)c1=O |
| InChI | InChI=1S/C33H46N6O6/c1-30-15-31(2)17-32(3,16-30)20-33(18-30,19-31)37-25(40)14-39-12-8-10-23(29(39)44)36-27(42)22(9-6-7-11-26(41)45-5)35-28(43)24-13-34-21-38(24)4/h7-8,10-13,21-22,26,41H,6,9,14-20H2,1-5H3,(H,35,43)(H,36,42)(H,37,40)/b11-7+/t22-,26?,30?,31?,32?,33?/m0/s1 |
| InChIKey | IXZPSQUXMIVXTN-PHUWKNDGSA-N |
| XLogP | 2.88 |
| TPSA | 156.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|