C25H31N7O6 — CID 135199823
(5S)-6-[[1-[2-(2-ethylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-5-[(3-methylimidazole-4-carbonyl)amino]-2,6-dioxohexanoyl cyanide (PubChem CID 135199823) has the molecular formula C25H31N7O6 and a molecular weight of 525.57 g/mol. Its IUPAC name is (5S)-6-[[1-[2-(2-ethylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-5-[(3-methylimidazole-4-carbonyl)amino]-2,6-dioxohexanoyl cyanide.
| Compound Name | (5S)-6-[[1-[2-(2-ethylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-5-[(3-methylimidazole-4-carbonyl)amino]-2,6-dioxohexanoyl cyanide |
|---|---|
| PubChem CID | 135199823 |
| Molecular Formula | C25H31N7O6 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | (5S)-6-[[1-[2-(2-ethylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-5-[(3-methylimidazole-4-carbonyl)amino]-2,6-dioxohexanoyl cyanide |
| SMILES | CCC(CC)CNC(=O)Cn1cccc(NC(=O)[C@H](CCC(=O)C(=O)C#N)NC(=O)c2cncn2C)c1=O |
| InChI | InChI=1S/C25H31N7O6/c1-4-16(5-2)12-28-22(35)14-32-10-6-7-18(25(32)38)30-23(36)17(8-9-20(33)21(34)11-26)29-24(37)19-13-27-15-31(19)3/h6-7,10,13,15-17H,4-5,8-9,12,14H2,1-3H3,(H,28,35)(H,29,37)(H,30,36)/t17-/m0/s1 |
| InChIKey | CSPUJKZFQGAUEH-KRWDZBQOSA-N |
| XLogP | 0.31 |
| TPSA | 185.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|