C29H40N4O8 — CID 162188950
2-methoxyethyl (5S)-7-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-5-[(3-methylimidazole-4-carbonyl)amino]-2,6-dioxoheptanoate (PubChem CID 162188950) has the molecular formula C29H40N4O8 and a molecular weight of 572.66 g/mol. Its IUPAC name is 2-methoxyethyl (5S)-7-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-5-[(3-methylimidazole-4-carbonyl)amino]-2,6-dioxoheptanoate.
| Compound Name | 2-methoxyethyl (5S)-7-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-5-[(3-methylimidazole-4-carbonyl)amino]-2,6-dioxoheptanoate |
|---|---|
| PubChem CID | 162188950 |
| Molecular Formula | C29H40N4O8 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | 2-methoxyethyl (5S)-7-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-5-[(3-methylimidazole-4-carbonyl)amino]-2,6-dioxoheptanoate |
| SMILES | CCC(CC)CCC(=O)Cn1cccc(CC(=O)[C@H](CCC(=O)C(=O)OCCOC)NC(=O)c2cncn2C)c1=O |
| InChI | InChI=1S/C29H40N4O8/c1-5-20(6-2)9-10-22(34)18-33-13-7-8-21(28(33)38)16-26(36)23(31-27(37)24-17-30-19-32(24)3)11-12-25(35)29(39)41-15-14-40-4/h7-8,13,17,19-20,23H,5-6,9-12,14-16,18H2,1-4H3,(H,31,37)/t23-/m0/s1 |
| InChIKey | ZQAQPODDPMUVHD-QHCPKHFHSA-N |
| XLogP | 1.82 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|