C26H37N7O4S — CID 172987022
N-[(3S,6Z)-6-(carbamothioylhydrazinylidene)-1-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-2-oxohexan-3-yl]-3-methylimidazole-4-carboxamide (PubChem CID 172987022) has the molecular formula C26H37N7O4S and a molecular weight of 543.69 g/mol. Its IUPAC name is N-[(3S,6Z)-6-(carbamothioylhydrazinylidene)-1-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-2-oxohexan-3-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[(3S,6Z)-6-(carbamothioylhydrazinylidene)-1-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-2-oxohexan-3-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 172987022 |
| Molecular Formula | C26H37N7O4S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | N-[(3S,6Z)-6-(carbamothioylhydrazinylidene)-1-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-2-oxohexan-3-yl]-3-methylimidazole-4-carboxamide |
| SMILES | CCC(CC)CCC(=O)Cn1cccc(CC(=O)[C@H](CC/C=N\NC(N)=S)NC(=O)c2cncn2C)c1=O |
| InChI | InChI=1S/C26H37N7O4S/c1-4-18(5-2)10-11-20(34)16-33-13-7-8-19(25(33)37)14-23(35)21(9-6-12-29-31-26(27)38)30-24(36)22-15-28-17-32(22)3/h7-8,12-13,15,17-18,21H,4-6,9-11,14,16H2,1-3H3,(H,30,36)(H3,27,31,38)/b29-12-/t21-/m0/s1 |
| InChIKey | ZJOLHTFBARHDRP-FABFYPQTSA-N |
| XLogP | 1.88 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|