C26H36N2O8 — CID 159743470
ethyl (E,6S)-6-acetamido-8-[1-[(4S)-4-methoxycarbonyl-5-methyl-2-oxohexyl]-2-oxo-3-pyridinyl]-7-oxooct-2-enoate (PubChem CID 159743470) has the molecular formula C26H36N2O8 and a molecular weight of 504.58 g/mol. Its IUPAC name is ethyl (E,6S)-6-acetamido-8-[1-[(4S)-4-methoxycarbonyl-5-methyl-2-oxohexyl]-2-oxo-3-pyridinyl]-7-oxooct-2-enoate.
| Compound Name | ethyl (E,6S)-6-acetamido-8-[1-[(4S)-4-methoxycarbonyl-5-methyl-2-oxohexyl]-2-oxo-3-pyridinyl]-7-oxooct-2-enoate |
|---|---|
| PubChem CID | 159743470 |
| Molecular Formula | C26H36N2O8 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | ethyl (E,6S)-6-acetamido-8-[1-[(4S)-4-methoxycarbonyl-5-methyl-2-oxohexyl]-2-oxo-3-pyridinyl]-7-oxooct-2-enoate |
| SMILES | CCOC(=O)/C=C/CC[C@H](NC(C)=O)C(=O)Cc1cccn(CC(=O)C[C@H](C(=O)OC)C(C)C)c1=O |
| InChI | InChI=1S/C26H36N2O8/c1-6-36-24(32)12-8-7-11-22(27-18(4)29)23(31)14-19-10-9-13-28(25(19)33)16-20(30)15-21(17(2)3)26(34)35-5/h8-10,12-13,17,21-22H,6-7,11,14-16H2,1-5H3,(H,27,29)/b12-8+/t21-,22-/m0/s1 |
| InChIKey | NCTGXDWXECRKNT-GQOFFSDZSA-N |
| XLogP | 1.77 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|