C26H38N2O6 — CID 158302307
ethyl (E,6S)-6-acetamido-8-[6-methyl-1-(6-methyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-7-oxooct-2-enoate (PubChem CID 158302307) has the molecular formula C26H38N2O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is ethyl (E,6S)-6-acetamido-8-[6-methyl-1-(6-methyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-7-oxooct-2-enoate.
| Compound Name | ethyl (E,6S)-6-acetamido-8-[6-methyl-1-(6-methyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-7-oxooct-2-enoate |
|---|---|
| PubChem CID | 158302307 |
| Molecular Formula | C26H38N2O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | ethyl (E,6S)-6-acetamido-8-[6-methyl-1-(6-methyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-7-oxooct-2-enoate |
| SMILES | CCOC(=O)/C=C/CC[C@H](NC(C)=O)C(=O)Cc1ccc(C)n(CC(=O)CCCC(C)C)c1=O |
| InChI | InChI=1S/C26H38N2O6/c1-6-34-25(32)13-8-7-12-23(27-20(5)29)24(31)16-21-15-14-19(4)28(26(21)33)17-22(30)11-9-10-18(2)3/h8,13-15,18,23H,6-7,9-12,16-17H2,1-5H3,(H,27,29)/b13-8+/t23-/m0/s1 |
| InChIKey | GMQIXTJVQWAMHL-NWMLYGLHSA-N |
| XLogP | 3.07 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|