C28H33NO7 — CID 58435742
1-O-ethyl 10-O-methyl (E,6S,9R)-9-benzyl-7-oxo-6-(phenylmethoxycarbonylamino)dec-2-enedioate (PubChem CID 58435742) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is 1-O-ethyl 10-O-methyl (E,6S,9R)-9-benzyl-7-oxo-6-(phenylmethoxycarbonylamino)dec-2-enedioate.
| Compound Name | 1-O-ethyl 10-O-methyl (E,6S,9R)-9-benzyl-7-oxo-6-(phenylmethoxycarbonylamino)dec-2-enedioate |
|---|---|
| PubChem CID | 58435742 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 1-O-ethyl 10-O-methyl (E,6S,9R)-9-benzyl-7-oxo-6-(phenylmethoxycarbonylamino)dec-2-enedioate |
| SMILES | CCOC(=O)/C=C/CC[C@H](NC(=O)OCc1ccccc1)C(=O)C[C@@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C28H33NO7/c1-3-35-26(31)17-11-10-16-24(29-28(33)36-20-22-14-8-5-9-15-22)25(30)19-23(27(32)34-2)18-21-12-6-4-7-13-21/h4-9,11-15,17,23-24H,3,10,16,18-20H2,1-2H3,(H,29,33)/b17-11+/t23-,24+/m1/s1 |
| InChIKey | HQSYNBVFPVPAHO-NXWZAAMYSA-N |
| XLogP | 4.17 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|