C22H32N4O5 — CID 158684400
(E,2S)-2-acetamido-7-oxo-N-[2-oxo-1-[2-oxo-2-(pentan-3-ylamino)ethyl]-3-pyridinyl]oct-5-enamide (PubChem CID 158684400) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is (E,2S)-2-acetamido-7-oxo-N-[2-oxo-1-[2-oxo-2-(pentan-3-ylamino)ethyl]-3-pyridinyl]oct-5-enamide.
| Compound Name | (E,2S)-2-acetamido-7-oxo-N-[2-oxo-1-[2-oxo-2-(pentan-3-ylamino)ethyl]-3-pyridinyl]oct-5-enamide |
|---|---|
| PubChem CID | 158684400 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (E,2S)-2-acetamido-7-oxo-N-[2-oxo-1-[2-oxo-2-(pentan-3-ylamino)ethyl]-3-pyridinyl]oct-5-enamide |
| SMILES | CCC(CC)NC(=O)Cn1cccc(NC(=O)[C@H](CC/C=C/C(C)=O)NC(C)=O)c1=O |
| InChI | InChI=1S/C22H32N4O5/c1-5-17(6-2)24-20(29)14-26-13-9-12-19(22(26)31)25-21(30)18(23-16(4)28)11-8-7-10-15(3)27/h7,9-10,12-13,17-18H,5-6,8,11,14H2,1-4H3,(H,23,28)(H,24,29)(H,25,30)/b10-7+/t18-/m0/s1 |
| InChIKey | XSHMNEAAICCTBK-HKMNZKMDSA-N |
| XLogP | 1.52 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|