C25H34N4O6S — CID 123228119
ethyl 6-(furan-3-ylsulfanylamino)-7-[[1-[2-(3-methylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate (PubChem CID 123228119) has the molecular formula C25H34N4O6S and a molecular weight of 518.64 g/mol. Its IUPAC name is ethyl 6-(furan-3-ylsulfanylamino)-7-[[1-[2-(3-methylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate.
| Compound Name | ethyl 6-(furan-3-ylsulfanylamino)-7-[[1-[2-(3-methylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 123228119 |
| Molecular Formula | C25H34N4O6S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | ethyl 6-(furan-3-ylsulfanylamino)-7-[[1-[2-(3-methylbutylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)C=CCCC(NSc1ccoc1)C(=O)Nc1cccn(CC(=O)NCCC(C)C)c1=O |
| InChI | InChI=1S/C25H34N4O6S/c1-4-35-23(31)10-6-5-8-20(28-36-19-12-15-34-17-19)24(32)27-21-9-7-14-29(25(21)33)16-22(30)26-13-11-18(2)3/h6-7,9-10,12,14-15,17-18,20,28H,4-5,8,11,13,16H2,1-3H3,(H,26,30)(H,27,32) |
| InChIKey | MRFCZMZYQVBLCQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 131.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|