C29H36N4O8 — CID 118104222
(2S)-2-[[2-[3-[[(E,2S)-2-benzamido-7-ethoxy-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]acetyl]amino]-3-methylpentanoic acid (PubChem CID 118104222) has the molecular formula C29H36N4O8 and a molecular weight of 568.63 g/mol. Its IUPAC name is (2S)-2-[[2-[3-[[(E,2S)-2-benzamido-7-ethoxy-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]acetyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[3-[[(E,2S)-2-benzamido-7-ethoxy-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]acetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 118104222 |
| Molecular Formula | C29H36N4O8 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | (2S)-2-[[2-[3-[[(E,2S)-2-benzamido-7-ethoxy-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]acetyl]amino]-3-methylpentanoic acid |
| SMILES | CCOC(=O)/C=C/CC[C@H](NC(=O)c1ccccc1)C(=O)Nc1cccn(CC(=O)N[C@H](C(=O)O)C(C)CC)c1=O |
| InChI | InChI=1S/C29H36N4O8/c1-4-19(3)25(29(39)40)32-23(34)18-33-17-11-15-22(28(33)38)31-27(37)21(14-9-10-16-24(35)41-5-2)30-26(36)20-12-7-6-8-13-20/h6-8,10-13,15-17,19,21,25H,4-5,9,14,18H2,1-3H3,(H,30,36)(H,31,37)(H,32,34)(H,39,40)/b16-10+/t19?,21-,25-/m0/s1 |
| InChIKey | OWCFVFHYYZCEHE-BBQCHBKJSA-N |
| XLogP | 2.10 |
| TPSA | 172.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|