C34H38F2N6O6 — CID 166455341
(2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(4,5-difluoro-1H-indole-2-carbonyl)amino]-N'-ethyl-5-oxohexanediamide (PubChem CID 166455341) has the molecular formula C34H38F2N6O6 and a molecular weight of 664.71 g/mol. Its IUPAC name is (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(4,5-difluoro-1H-indole-2-carbonyl)amino]-N'-ethyl-5-oxohexanediamide.
| Compound Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(4,5-difluoro-1H-indole-2-carbonyl)amino]-N'-ethyl-5-oxohexanediamide |
|---|---|
| PubChem CID | 166455341 |
| Molecular Formula | C34H38F2N6O6 |
| Molecular Weight | 664.71 g/mol |
| Exact Mass | 664.28 |
| IUPAC Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[(4,5-difluoro-1H-indole-2-carbonyl)amino]-N'-ethyl-5-oxohexanediamide |
| SMILES | CCNC(=O)C(=O)CC[C@H](NC(=O)c1cc2c(F)c(F)ccc2[nH]1)C(=O)Nc1cccn(CC(=O)NC2C3CC4CC(C3)CC2C4)c1=O |
| InChI | InChI=1S/C34H38F2N6O6/c1-2-37-33(47)27(43)8-7-24(39-32(46)26-15-21-23(38-26)6-5-22(35)29(21)36)31(45)40-25-4-3-9-42(34(25)48)16-28(44)41-30-19-11-17-10-18(13-19)14-20(30)12-17/h3-6,9,15,17-20,24,30,38H,2,7-8,10-14,16H2,1H3,(H,37,47)(H,39,46)(H,40,45)(H,41,44)/t17?,18?,19?,20?,24-,30?/m0/s1 |
| InChIKey | TTWHWBYHBRJULL-VVQXHFFKSA-N |
| XLogP | 2.77 |
| TPSA | 171.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|