C27H33N7O6 — CID 167291699
(2S)-N-[1-[2-(7-bicyclo[2.2.1]heptanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-5-oxo-2-(pyridazine-4-carbonylamino)hexanediamide (PubChem CID 167291699) has the molecular formula C27H33N7O6 and a molecular weight of 551.60 g/mol. Its IUPAC name is (2S)-N-[1-[2-(7-bicyclo[2.2.1]heptanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-5-oxo-2-(pyridazine-4-carbonylamino)hexanediamide.
| Compound Name | (2S)-N-[1-[2-(7-bicyclo[2.2.1]heptanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-5-oxo-2-(pyridazine-4-carbonylamino)hexanediamide |
|---|---|
| PubChem CID | 167291699 |
| Molecular Formula | C27H33N7O6 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | (2S)-N-[1-[2-(7-bicyclo[2.2.1]heptanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-5-oxo-2-(pyridazine-4-carbonylamino)hexanediamide |
| SMILES | CCNC(=O)C(=O)CC[C@H](NC(=O)c1ccnnc1)C(=O)Nc1cccn(CC(=O)NC2C3CCC2CC3)c1=O |
| InChI | InChI=1S/C27H33N7O6/c1-2-28-26(39)21(35)10-9-19(31-24(37)18-11-12-29-30-14-18)25(38)32-20-4-3-13-34(27(20)40)15-22(36)33-23-16-5-6-17(23)8-7-16/h3-4,11-14,16-17,19,23H,2,5-10,15H2,1H3,(H,28,39)(H,31,37)(H,32,38)(H,33,36)/t16?,17?,19-,23?/m0/s1 |
| InChIKey | RDSRQZWSBMPQPU-CQECULCQSA-N |
| XLogP | 0.17 |
| TPSA | 181.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|